C14H20F2N2O — CID 105407826
2-[4-[(3,5-difluorophenyl)methyl]-1,4-diazepan-1-yl]ethanol (PubChem CID 105407826) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-[4-[(3,5-difluorophenyl)methyl]-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-[(3,5-difluorophenyl)methyl]-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 105407826 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[4-[(3,5-difluorophenyl)methyl]-1,4-diazepan-1-yl]ethanol |
| SMILES | OCCN1CCCN(Cc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C14H20F2N2O/c15-13-8-12(9-14(16)10-13)11-18-3-1-2-17(4-5-18)6-7-19/h8-10,19H,1-7,11H2 |
| InChIKey | YJNCDPBHVWPSCV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |