C17H22O4 — CID 10541519
methyl (2R,4R)-4-prop-2-enyl-2-(2,4,6-trimethylphenyl)-1,3-dioxolane-4-carboxylate (PubChem CID 10541519) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl (2R,4R)-4-prop-2-enyl-2-(2,4,6-trimethylphenyl)-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (2R,4R)-4-prop-2-enyl-2-(2,4,6-trimethylphenyl)-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 10541519 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | methyl (2R,4R)-4-prop-2-enyl-2-(2,4,6-trimethylphenyl)-1,3-dioxolane-4-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)CO[C@@H](c2c(C)cc(C)cc2C)O1 |
| InChI | InChI=1S/C17H22O4/c1-6-7-17(16(18)19-5)10-20-15(21-17)14-12(3)8-11(2)9-13(14)4/h6,8-9,15H,1,7,10H2,2-5H3/t15-,17-/m1/s1 |
| InChIKey | RVTWXWANTLMLRA-NVXWUHKLSA-N |
| XLogP | 3.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|