C13H9NO5S — CID 10541580
dimethyl 3-isocyanato-1-benzothiophene-2,5-dicarboxylate (PubChem CID 10541580) has the molecular formula C13H9NO5S and a molecular weight of 291.28 g/mol. Its IUPAC name is dimethyl 3-isocyanato-1-benzothiophene-2,5-dicarboxylate.
| Compound Name | dimethyl 3-isocyanato-1-benzothiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 10541580 |
| Molecular Formula | C13H9NO5S |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | dimethyl 3-isocyanato-1-benzothiophene-2,5-dicarboxylate |
| SMILES | COC(=O)c1ccc2sc(C(=O)OC)c(N=C=O)c2c1 |
| InChI | InChI=1S/C13H9NO5S/c1-18-12(16)7-3-4-9-8(5-7)10(14-6-15)11(20-9)13(17)19-2/h3-5H,1-2H3 |
| InChIKey | SCAFCDDEMQZTSR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|