C20H26N2O6S — CID 90457180
dimethyl 3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]-1-benzothiophene-2,5-dicarboxylate (PubChem CID 90457180) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is dimethyl 3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]-1-benzothiophene-2,5-dicarboxylate.
| Compound Name | dimethyl 3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]-1-benzothiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 90457180 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | dimethyl 3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]-1-benzothiophene-2,5-dicarboxylate |
| SMILES | COC(=O)c1ccc2sc(C(=O)OC)c(NC[C@@H](C)NC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C20H26N2O6S/c1-11(22-19(25)28-20(2,3)4)10-21-15-13-9-12(17(23)26-5)7-8-14(13)29-16(15)18(24)27-6/h7-9,11,21H,10H2,1-6H3,(H,22,25)/t11-/m1/s1 |
| InChIKey | OMKBTMMTUOECQH-LLVKDONJSA-N |
| XLogP | 3.80 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|