C13H17Cl2N3O2 — CID 105418877
4,5-dichloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-2-nitroaniline (PubChem CID 105418877) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is 4,5-dichloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-2-nitroaniline.
| Compound Name | 4,5-dichloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 105418877 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4,5-dichloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-2-nitroaniline |
| SMILES | CN(C)C1(CNc2cc(Cl)c(Cl)cc2[N+](=O)[O-])CCC1 |
| InChI | InChI=1S/C13H17Cl2N3O2/c1-17(2)13(4-3-5-13)8-16-11-6-9(14)10(15)7-12(11)18(19)20/h6-7,16H,3-5,8H2,1-2H3 |
| InChIKey | LSDOPAZTZANGSC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|