C12H14Cl2N2O4 — CID 106102476
3-[(4,5-dichloro-2-nitroanilino)methyl]-2-methyloxolan-3-ol (PubChem CID 106102476) has the molecular formula C12H14Cl2N2O4 and a molecular weight of 321.16 g/mol. Its IUPAC name is 3-[(4,5-dichloro-2-nitroanilino)methyl]-2-methyloxolan-3-ol.
| Compound Name | 3-[(4,5-dichloro-2-nitroanilino)methyl]-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 106102476 |
| Molecular Formula | C12H14Cl2N2O4 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 3-[(4,5-dichloro-2-nitroanilino)methyl]-2-methyloxolan-3-ol |
| SMILES | CC1OCCC1(O)CNc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14Cl2N2O4/c1-7-12(17,2-3-20-7)6-15-10-4-8(13)9(14)5-11(10)16(18)19/h4-5,7,15,17H,2-3,6H2,1H3 |
| InChIKey | XRAPWGNMTJFXJF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|