About (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol
(E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol (PubChem CID 10542203) has the molecular formula C15H12N2O5
and a molecular weight of 300.27 g/mol. Its IUPAC name is (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol |
| PubChem CID | 10542203 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol |
| SMILES | O=[N+]([O-])c1ccccc1/C=C(/CO)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12N2O5/c18-10-12(13-6-2-4-8-15(13)17(21)22)9-11-5-1-3-7-14(11)16(19)20/h1-9,18H,10H2/b12-9- |
| InChIKey | WWUGYHCLFJNTGR-XFXZXTDPSA-N |
| XLogP | 3.04 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol?
The IUPAC name of (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol (CID 10542203) is (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol.
What is the SMILES notation for (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol?
The canonical SMILES for (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol is O=[N+]([O-])c1ccccc1/C=C(/CO)c1ccccc1[N+](=O)[O-].
What is the InChIKey of (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol?
The InChIKey is WWUGYHCLFJNTGR-XFXZXTDPSA-N. The full InChI is InChI=1S/C15H12N2O5/c18-10-12(13-6-2-4-8-15(13)17(21)22)9-11-5-1-3-7-14(11)16(19)20/h1-9,18H,10H2/b12-9-.
What are the key properties of (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol?
(E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol has a molecular weight of 300.27 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-bis(2-nitrophenyl)prop-2-en-1-ol is sourced from PubChem (CID 10542203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).