C9H5ClF3NO2 — CID 101491955
1-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2-nitrobenzene (PubChem CID 101491955) has the molecular formula C9H5ClF3NO2 and a molecular weight of 251.59 g/mol. Its IUPAC name is 1-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2-nitrobenzene.
| Compound Name | 1-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2-nitrobenzene |
|---|---|
| PubChem CID | 101491955 |
| Molecular Formula | C9H5ClF3NO2 |
| Molecular Weight | 251.59 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 1-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccccc1/C=C(\Cl)C(F)(F)F |
| InChI | InChI=1S/C9H5ClF3NO2/c10-8(9(11,12)13)5-6-3-1-2-4-7(6)14(15)16/h1-5H/b8-5- |
| InChIKey | WWDOZCXTUWPYID-YVMONPNESA-N |
| XLogP | 3.74 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|