C19H26O3 — CID 10542412
(2R,5R)-2-tert-butyl-5-cyclohexyl-5-phenyl-1,3-dioxolan-4-one (PubChem CID 10542412) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (2R,5R)-2-tert-butyl-5-cyclohexyl-5-phenyl-1,3-dioxolan-4-one.
| Compound Name | (2R,5R)-2-tert-butyl-5-cyclohexyl-5-phenyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 10542412 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2R,5R)-2-tert-butyl-5-cyclohexyl-5-phenyl-1,3-dioxolan-4-one |
| SMILES | CC(C)(C)[C@H]1OC(=O)[C@](c2ccccc2)(C2CCCCC2)O1 |
| InChI | InChI=1S/C19H26O3/c1-18(2,3)17-21-16(20)19(22-17,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4,6-7,10-11,15,17H,5,8-9,12-13H2,1-3H3/t17-,19-/m0/s1 |
| InChIKey | CICIFEMCFDCMNM-HKUYNNGSSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |