C10H13Br2N — CID 105424502
2-(3,4-dibromophenyl)-N-methylpropan-1-amine (PubChem CID 105424502) has the molecular formula C10H13Br2N and a molecular weight of 307.03 g/mol. Its IUPAC name is 2-(3,4-dibromophenyl)-N-methylpropan-1-amine.
| Compound Name | 2-(3,4-dibromophenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 105424502 |
| Molecular Formula | C10H13Br2N |
| Molecular Weight | 307.03 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | 2-(3,4-dibromophenyl)-N-methylpropan-1-amine |
| SMILES | CNCC(C)c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C10H13Br2N/c1-7(6-13-2)8-3-4-9(11)10(12)5-8/h3-5,7,13H,6H2,1-2H3 |
| InChIKey | GPFYFLIPTDLEFD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.03 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |