C14H13ClN4S — CID 10542587
3-(chloromethyl)-2-methyl-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]quinoline (PubChem CID 10542587) has the molecular formula C14H13ClN4S and a molecular weight of 304.81 g/mol. Its IUPAC name is 3-(chloromethyl)-2-methyl-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]quinoline.
| Compound Name | 3-(chloromethyl)-2-methyl-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]quinoline |
|---|---|
| PubChem CID | 10542587 |
| Molecular Formula | C14H13ClN4S |
| Molecular Weight | 304.81 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-(chloromethyl)-2-methyl-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]quinoline |
| SMILES | Cc1nc(Sc2c(CCl)c(C)nc3ccccc23)n[nH]1 |
| InChI | InChI=1S/C14H13ClN4S/c1-8-11(7-15)13(20-14-17-9(2)18-19-14)10-5-3-4-6-12(10)16-8/h3-6H,7H2,1-2H3,(H,17,18,19) |
| InChIKey | FBOGLEYIOYLWHJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|