C10H11ClO3 — CID 105425981
4-chloro-5-[1-(hydroxymethyl)cyclopropyl]benzene-1,2-diol (PubChem CID 105425981) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is 4-chloro-5-[1-(hydroxymethyl)cyclopropyl]benzene-1,2-diol.
| Compound Name | 4-chloro-5-[1-(hydroxymethyl)cyclopropyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 105425981 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 4-chloro-5-[1-(hydroxymethyl)cyclopropyl]benzene-1,2-diol |
| SMILES | OCC1(c2cc(O)c(O)cc2Cl)CC1 |
| InChI | InChI=1S/C10H11ClO3/c11-7-4-9(14)8(13)3-6(7)10(5-12)1-2-10/h3-4,12-14H,1-2,5H2 |
| InChIKey | QJRQALYFYUDSES-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|