C10H10O — CID 105428926
5-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carbaldehyde (PubChem CID 105428926) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 5-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carbaldehyde.
| Compound Name | 5-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carbaldehyde |
|---|---|
| PubChem CID | 105428926 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 5-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carbaldehyde |
| SMILES | Cc1cccc2c1C(C=O)C2 |
| InChI | InChI=1S/C10H10O/c1-7-3-2-4-8-5-9(6-11)10(7)8/h2-4,6,9H,5H2,1H3 |
| InChIKey | FPHUBLLYCUZFLU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|