C14H22O2 — CID 143584856
ethane;methanol;4-methyl-2,3-dihydro-1H-indene-2-carbaldehyde (PubChem CID 143584856) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is ethane;methanol;4-methyl-2,3-dihydro-1H-indene-2-carbaldehyde.
| Compound Name | ethane;methanol;4-methyl-2,3-dihydro-1H-indene-2-carbaldehyde |
|---|---|
| PubChem CID | 143584856 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | ethane;methanol;4-methyl-2,3-dihydro-1H-indene-2-carbaldehyde |
| SMILES | CC.CO.Cc1cccc2c1CC(C=O)C2 |
| InChI | InChI=1S/C11H12O.C2H6.CH4O/c1-8-3-2-4-10-5-9(7-12)6-11(8)10;2*1-2/h2-4,7,9H,5-6H2,1H3;1-2H3;2H,1H3 |
| InChIKey | WVGFNZDDGJTWOX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|