C17H18 — CID 59215088
5-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 59215088) has the molecular formula C17H18 and a molecular weight of 222.33 g/mol. Its IUPAC name is 5-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 59215088 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 5-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1cccc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C17H18/c1-13-6-5-9-16-12-15(10-11-17(13)16)14-7-3-2-4-8-14/h2-9,15H,10-12H2,1H3 |
| InChIKey | RVNNOMJNCAUQFB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |