C21H24 — CID 91231570
8-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 91231570) has the molecular formula C21H24 and a molecular weight of 276.42 g/mol. Its IUPAC name is 8-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 8-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 91231570 |
| Molecular Formula | C21H24 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 8-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1cccc2c1CC(c1ccc3c(c1)CCCC3)CC2 |
| InChI | InChI=1S/C21H24/c1-15-5-4-8-17-10-12-20(14-21(15)17)19-11-9-16-6-2-3-7-18(16)13-19/h4-5,8-9,11,13,20H,2-3,6-7,10,12,14H2,1H3 |
| InChIKey | ISRKKXHUYQJRQQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |