C7H12N4 — CID 105429780
5-(2-methylpropyl)-1,2,4-triazin-3-amine (PubChem CID 105429780) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 5-(2-methylpropyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(2-methylpropyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105429780 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 5-(2-methylpropyl)-1,2,4-triazin-3-amine |
| SMILES | CC(C)Cc1cnnc(N)n1 |
| InChI | InChI=1S/C7H12N4/c1-5(2)3-6-4-9-11-7(8)10-6/h4-5H,3H2,1-2H3,(H2,8,10,11) |
| InChIKey | KOUOYJGZHBYDMH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |