2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid

C9H13N3O2 — CID 105448907

IUPAC2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid
SMILESCC(C)Cc1cnnc(CC(=O)O)n1
InChIInChI=1S/C9H13N3O2/c1-6(2)3-7-5-10-12-8(11-7)4-9(13)14/h5-6H,3-4H2,1-2H3,(H,13,14)
InChIKeyFRYZXHGHDTWWKH-UHFFFAOYSA-N
MW195.22 g/mol
LogP0.70
Rot. Bonds4

About 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid

2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid (PubChem CID 105448907) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid
PubChem CID105448907
Molecular FormulaC9H13N3O2
Molecular Weight195.22 g/mol
Exact Mass195.10
IUPAC Name2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid
SMILESCC(C)Cc1cnnc(CC(=O)O)n1
InChIInChI=1S/C9H13N3O2/c1-6(2)3-7-5-10-12-8(11-7)4-9(13)14/h5-6H,3-4H2,1-2H3,(H,13,14)
InChIKeyFRYZXHGHDTWWKH-UHFFFAOYSA-N
XLogP0.70
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.22
LogP ≤ 50.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid?
The IUPAC name of 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid (CID 105448907) is 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid.
What is the SMILES notation for 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid?
The canonical SMILES for 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid is CC(C)Cc1cnnc(CC(=O)O)n1.
What is the InChIKey of 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid?
The InChIKey is FRYZXHGHDTWWKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-6(2)3-7-5-10-12-8(11-7)4-9(13)14/h5-6H,3-4H2,1-2H3,(H,13,14).
What are the key properties of 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid?
2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid has a molecular weight of 195.22 g/mol, XLogP of 0.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid is sourced from PubChem (CID 105448907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).