C9H13N3O2 — CID 105448907
2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid (PubChem CID 105448907) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid.
| Compound Name | 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid |
|---|---|
| PubChem CID | 105448907 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-[5-(2-methylpropyl)-1,2,4-triazin-3-yl]acetic acid |
| SMILES | CC(C)Cc1cnnc(CC(=O)O)n1 |
| InChI | InChI=1S/C9H13N3O2/c1-6(2)3-7-5-10-12-8(11-7)4-9(13)14/h5-6H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | FRYZXHGHDTWWKH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |