3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid

C5H6N4O2 — CID 22099275

IUPAC3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid
SMILESNCc1nncc(C(=O)O)n1
InChIInChI=1S/C5H6N4O2/c6-1-4-8-3(5(10)11)2-7-9-4/h2H,1,6H2,(H,10,11)
InChIKeyYVNFMLSTRPAIEU-UHFFFAOYSA-N
MW154.13 g/mol
LogP-0.97
Rot. Bonds2

About 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid

3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid (PubChem CID 22099275) has the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. Its IUPAC name is 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid.

Molecular Properties

Compound Name3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid
PubChem CID22099275
Molecular FormulaC5H6N4O2
Molecular Weight154.13 g/mol
Exact Mass154.05
IUPAC Name3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid
SMILESNCc1nncc(C(=O)O)n1
InChIInChI=1S/C5H6N4O2/c6-1-4-8-3(5(10)11)2-7-9-4/h2H,1,6H2,(H,10,11)
InChIKeyYVNFMLSTRPAIEU-UHFFFAOYSA-N
XLogP-0.97
TPSA101.99 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.13
LogP ≤ 5-0.97
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid?
The IUPAC name of 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid (CID 22099275) is 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid.
What is the SMILES notation for 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid?
The canonical SMILES for 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid is NCc1nncc(C(=O)O)n1.
What is the InChIKey of 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid?
The InChIKey is YVNFMLSTRPAIEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O2/c6-1-4-8-3(5(10)11)2-7-9-4/h2H,1,6H2,(H,10,11).
What are the key properties of 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid?
3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid has a molecular weight of 154.13 g/mol, XLogP of -0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid is sourced from PubChem (CID 22099275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).