C5H6N4O2 — CID 22099275
3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid (PubChem CID 22099275) has the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. Its IUPAC name is 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid.
| Compound Name | 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid |
|---|---|
| PubChem CID | 22099275 |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 3-(aminomethyl)-1,2,4-triazine-5-carboxylic acid |
| SMILES | NCc1nncc(C(=O)O)n1 |
| InChI | InChI=1S/C5H6N4O2/c6-1-4-8-3(5(10)11)2-7-9-4/h2H,1,6H2,(H,10,11) |
| InChIKey | YVNFMLSTRPAIEU-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |