3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid

C9H13N3O2 — CID 105448909

IUPAC3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid
SMILESCCCc1cnnc(CCC(=O)O)n1
InChIInChI=1S/C9H13N3O2/c1-2-3-7-6-10-12-8(11-7)4-5-9(13)14/h6H,2-5H2,1H3,(H,13,14)
InChIKeyWNVHSRYIXXBNCD-UHFFFAOYSA-N
MW195.22 g/mol
LogP0.84
Rot. Bonds5

About 3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid

3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid (PubChem CID 105448909) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid.

Molecular Properties

Compound Name3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid
PubChem CID105448909
Molecular FormulaC9H13N3O2
Molecular Weight195.22 g/mol
Exact Mass195.10
IUPAC Name3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid
SMILESCCCc1cnnc(CCC(=O)O)n1
InChIInChI=1S/C9H13N3O2/c1-2-3-7-6-10-12-8(11-7)4-5-9(13)14/h6H,2-5H2,1H3,(H,13,14)
InChIKeyWNVHSRYIXXBNCD-UHFFFAOYSA-N
XLogP0.84
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.22
LogP ≤ 50.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid?
The IUPAC name of 3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid (CID 105448909) is 3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid.
What is the SMILES notation for 3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid?
The canonical SMILES for 3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid is CCCc1cnnc(CCC(=O)O)n1.
What is the InChIKey of 3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid?
The InChIKey is WNVHSRYIXXBNCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-2-3-7-6-10-12-8(11-7)4-5-9(13)14/h6H,2-5H2,1H3,(H,13,14).
What are the key properties of 3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid?
3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid has a molecular weight of 195.22 g/mol, XLogP of 0.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-propyl-1,2,4-triazin-3-yl)propanoic acid is sourced from PubChem (CID 105448909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).