C7H9N3O2 — CID 82413919
3-(6-methyl-1,2,4-triazin-3-yl)propanoic acid (PubChem CID 82413919) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is 3-(6-methyl-1,2,4-triazin-3-yl)propanoic acid.
| Compound Name | 3-(6-methyl-1,2,4-triazin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 82413919 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 3-(6-methyl-1,2,4-triazin-3-yl)propanoic acid |
| SMILES | Cc1cnc(CCC(=O)O)nn1 |
| InChI | InChI=1S/C7H9N3O2/c1-5-4-8-6(10-9-5)2-3-7(11)12/h4H,2-3H2,1H3,(H,11,12) |
| InChIKey | ISJGYQPDABCXEU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |