C6H7N3O2 — CID 105429838
3-ethoxy-1,2,4-triazine-5-carbaldehyde (PubChem CID 105429838) has the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. Its IUPAC name is 3-ethoxy-1,2,4-triazine-5-carbaldehyde.
| Compound Name | 3-ethoxy-1,2,4-triazine-5-carbaldehyde |
|---|---|
| PubChem CID | 105429838 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | 3-ethoxy-1,2,4-triazine-5-carbaldehyde |
| SMILES | CCOc1nncc(C=O)n1 |
| InChI | InChI=1S/C6H7N3O2/c1-2-11-6-8-5(4-10)3-7-9-6/h3-4H,2H2,1H3 |
| InChIKey | GUKSCEUQYQIZCE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|