C7H12N2O2 — CID 105430507
1-(hydroxymethyl)-2,5-diazabicyclo[2.2.2]octan-3-one (PubChem CID 105430507) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 1-(hydroxymethyl)-2,5-diazabicyclo[2.2.2]octan-3-one.
| Compound Name | 1-(hydroxymethyl)-2,5-diazabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 105430507 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-(hydroxymethyl)-2,5-diazabicyclo[2.2.2]octan-3-one |
| SMILES | O=C1NC2(CO)CCC1NC2 |
| InChI | InChI=1S/C7H12N2O2/c10-4-7-2-1-5(8-3-7)6(11)9-7/h5,8,10H,1-4H2,(H,9,11) |
| InChIKey | YEIUSMNZQYSAKP-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |