About 1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine
1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine (PubChem CID 105433888) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine.
Analyze 1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine?
The IUPAC name of 1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine (CID 105433888) is 1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine?
The canonical SMILES for 1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine is CC(c1ccc(CN)o1)N(C)C.
What is the InChIKey of 1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine?
The InChIKey is VMJFJXADFAHTRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-7(11(2)3)9-5-4-8(6-10)12-9/h4-5,7H,6,10H2,1-3H3.
What are the key properties of 1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine?
1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine has a molecular weight of 168.24 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(aminomethyl)furan-2-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 105433888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).