About 2-fluoropropane;(5-methylfuran-2-yl)methanamine
2-fluoropropane;(5-methylfuran-2-yl)methanamine (PubChem CID 142882995) has the molecular formula C9H16FNO
and a molecular weight of 173.23 g/mol. Its IUPAC name is 2-fluoropropane;(5-methylfuran-2-yl)methanamine.
Molecular Properties
| Compound Name | 2-fluoropropane;(5-methylfuran-2-yl)methanamine |
| PubChem CID | 142882995 |
| Molecular Formula | C9H16FNO |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-fluoropropane;(5-methylfuran-2-yl)methanamine |
| SMILES | CC(C)F.Cc1ccc(CN)o1 |
| InChI | InChI=1S/C6H9NO.C3H7F/c1-5-2-3-6(4-7)8-5;1-3(2)4/h2-3H,4,7H2,1H3;3H,1-2H3 |
| InChIKey | FXLYXEPRPSGSKC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoropropane;(5-methylfuran-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoropropane;(5-methylfuran-2-yl)methanamine?
The IUPAC name of 2-fluoropropane;(5-methylfuran-2-yl)methanamine (CID 142882995) is 2-fluoropropane;(5-methylfuran-2-yl)methanamine.
What is the SMILES notation for 2-fluoropropane;(5-methylfuran-2-yl)methanamine?
The canonical SMILES for 2-fluoropropane;(5-methylfuran-2-yl)methanamine is CC(C)F.Cc1ccc(CN)o1.
What is the InChIKey of 2-fluoropropane;(5-methylfuran-2-yl)methanamine?
The InChIKey is FXLYXEPRPSGSKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C3H7F/c1-5-2-3-6(4-7)8-5;1-3(2)4/h2-3H,4,7H2,1H3;3H,1-2H3.
What are the key properties of 2-fluoropropane;(5-methylfuran-2-yl)methanamine?
2-fluoropropane;(5-methylfuran-2-yl)methanamine has a molecular weight of 173.23 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoropropane;(5-methylfuran-2-yl)methanamine is sourced from PubChem (CID 142882995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).