C11H20N2O — CID 105450223
1-[5-(aminomethyl)furan-2-yl]-N,N-diethylethanamine (PubChem CID 105450223) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-[5-(aminomethyl)furan-2-yl]-N,N-diethylethanamine.
| Compound Name | 1-[5-(aminomethyl)furan-2-yl]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 105450223 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-[5-(aminomethyl)furan-2-yl]-N,N-diethylethanamine |
| SMILES | CCN(CC)C(C)c1ccc(CN)o1 |
| InChI | InChI=1S/C11H20N2O/c1-4-13(5-2)9(3)11-7-6-10(8-12)14-11/h6-7,9H,4-5,8,12H2,1-3H3 |
| InChIKey | MQWNVUQLDDUHTR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |