C15H10ClN3O3 — CID 10543398
7-methyl-2,4-dioxo-3-phenyl-1H-pyrido[2,3-d]pyrimidine-5-carbonyl chloride (PubChem CID 10543398) has the molecular formula C15H10ClN3O3 and a molecular weight of 315.72 g/mol. Its IUPAC name is 7-methyl-2,4-dioxo-3-phenyl-1H-pyrido[2,3-d]pyrimidine-5-carbonyl chloride.
| Compound Name | 7-methyl-2,4-dioxo-3-phenyl-1H-pyrido[2,3-d]pyrimidine-5-carbonyl chloride |
|---|---|
| PubChem CID | 10543398 |
| Molecular Formula | C15H10ClN3O3 |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 7-methyl-2,4-dioxo-3-phenyl-1H-pyrido[2,3-d]pyrimidine-5-carbonyl chloride |
| SMILES | Cc1cc(C(=O)Cl)c2c(=O)n(-c3ccccc3)c(=O)[nH]c2n1 |
| InChI | InChI=1S/C15H10ClN3O3/c1-8-7-10(12(16)20)11-13(17-8)18-15(22)19(14(11)21)9-5-3-2-4-6-9/h2-7H,1H3,(H,17,18,22) |
| InChIKey | XPNZAPYUSNSNQK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|