C8H8FNO2 — CID 105434012
4-fluoro-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbaldehyde (PubChem CID 105434012) has the molecular formula C8H8FNO2 and a molecular weight of 169.16 g/mol. Its IUPAC name is 4-fluoro-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbaldehyde.
| Compound Name | 4-fluoro-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 105434012 |
| Molecular Formula | C8H8FNO2 |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 4-fluoro-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbaldehyde |
| SMILES | O=Cc1noc2c1C(F)CCC2 |
| InChI | InChI=1S/C8H8FNO2/c9-5-2-1-3-7-8(5)6(4-11)10-12-7/h4-5H,1-3H2 |
| InChIKey | HKDZWPNWTHBKJY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|