About 8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane
8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane (PubChem CID 105435254) has the molecular formula C9H17FN2
and a molecular weight of 172.25 g/mol. Its IUPAC name is 8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane.
Analyze 8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane?
The IUPAC name of 8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane (CID 105435254) is 8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane.
What is the SMILES notation for 8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane?
The canonical SMILES for 8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane is CC(C)N1CC2CNCC1C2F.
What is the InChIKey of 8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane?
The InChIKey is JXLYQEGAENNTMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17FN2/c1-6(2)12-5-7-3-11-4-8(12)9(7)10/h6-9,11H,3-5H2,1-2H3.
What are the key properties of 8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane?
8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane has a molecular weight of 172.25 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-6-propan-2-yl-3,6-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 105435254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).