C12H14O — CID 105435841
2-(5-methyl-2,3-dihydro-1H-inden-1-yl)acetaldehyde (PubChem CID 105435841) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-(5-methyl-2,3-dihydro-1H-inden-1-yl)acetaldehyde.
| Compound Name | 2-(5-methyl-2,3-dihydro-1H-inden-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 105435841 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-(5-methyl-2,3-dihydro-1H-inden-1-yl)acetaldehyde |
| SMILES | Cc1ccc2c(c1)CCC2CC=O |
| InChI | InChI=1S/C12H14O/c1-9-2-5-12-10(6-7-13)3-4-11(12)8-9/h2,5,7-8,10H,3-4,6H2,1H3 |
| InChIKey | RMPHROOTFQDTEE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|