C17H24O4 — CID 88970878
2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde (PubChem CID 88970878) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde.
| Compound Name | 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 88970878 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde |
| SMILES | CCOC(COc1ccc2c(c1)CC[C@H]2CC=O)OCC |
| InChI | InChI=1S/C17H24O4/c1-3-19-17(20-4-2)12-21-15-7-8-16-13(9-10-18)5-6-14(16)11-15/h7-8,10-11,13,17H,3-6,9,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | BDNOLRZYVXURNT-ZDUSSCGKSA-N |
| XLogP | 3.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|