About 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde
2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde (PubChem CID 88970878) has the molecular formula C17H24O4
and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde |
| PubChem CID | 88970878 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde |
| SMILES | CCOC(COc1ccc2c(c1)CC[C@H]2CC=O)OCC |
| InChI | InChI=1S/C17H24O4/c1-3-19-17(20-4-2)12-21-15-7-8-16-13(9-10-18)5-6-14(16)11-15/h7-8,10-11,13,17H,3-6,9,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | BDNOLRZYVXURNT-ZDUSSCGKSA-N |
| XLogP | 3.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde?
The IUPAC name of 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde (CID 88970878) is 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde.
What is the SMILES notation for 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde?
The canonical SMILES for 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde is CCOC(COc1ccc2c(c1)CC[C@H]2CC=O)OCC.
What is the InChIKey of 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde?
The InChIKey is BDNOLRZYVXURNT-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H24O4/c1-3-19-17(20-4-2)12-21-15-7-8-16-13(9-10-18)5-6-14(16)11-15/h7-8,10-11,13,17H,3-6,9,12H2,1-2H3/t13-/m0/s1.
What are the key properties of 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde?
2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde has a molecular weight of 292.38 g/mol, XLogP of 3.08, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-5-(2,2-diethoxyethoxy)-2,3-dihydro-1H-inden-1-yl]acetaldehyde is sourced from PubChem (CID 88970878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).