C26H28IN3O3 — CID 89066277
2-[(1S)-5-[3-[[2-iodo-5-(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetaldehyde (PubChem CID 89066277) has the molecular formula C26H28IN3O3 and a molecular weight of 557.43 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[[2-iodo-5-(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetaldehyde.
| Compound Name | 2-[(1S)-5-[3-[[2-iodo-5-(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 89066277 |
| Molecular Formula | C26H28IN3O3 |
| Molecular Weight | 557.43 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | 2-[(1S)-5-[3-[[2-iodo-5-(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetaldehyde |
| SMILES | COc1ccc(-c2cnc(I)nc2N(C)CCCOc2ccc3c(c2)CC[C@H]3CC=O)cc1 |
| InChI | InChI=1S/C26H28IN3O3/c1-30(25-24(17-28-26(27)29-25)18-6-8-21(32-2)9-7-18)13-3-15-33-22-10-11-23-19(12-14-31)4-5-20(23)16-22/h6-11,14,16-17,19H,3-5,12-13,15H2,1-2H3/t19-/m0/s1 |
| InChIKey | DPINBGKOMAIAPS-IBGZPJMESA-N |
| XLogP | 5.28 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|