C23H25N3O3S — CID 67018993
2-[(1S)-5-[3-[methyl-(5-thiophen-3-ylpyrimidin-2-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 67018993) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[methyl-(5-thiophen-3-ylpyrimidin-2-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-[methyl-(5-thiophen-3-ylpyrimidin-2-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 67018993 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-[(1S)-5-[3-[methyl-(5-thiophen-3-ylpyrimidin-2-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | CN(CCCOc1ccc2c(c1)CC[C@H]2CC(=O)O)c1ncc(-c2ccsc2)cn1 |
| InChI | InChI=1S/C23H25N3O3S/c1-26(23-24-13-19(14-25-23)18-7-10-30-15-18)8-2-9-29-20-5-6-21-16(11-20)3-4-17(21)12-22(27)28/h5-7,10-11,13-15,17H,2-4,8-9,12H2,1H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | OFJCTFHZWDPBHX-KRWDZBQOSA-N |
| XLogP | 4.61 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|