C26H31N3O3S — CID 67019039
2-[(1S)-5-[3-[1-(5-methyl-2-thiophen-3-ylpyrimidin-4-yl)propylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 67019039) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[1-(5-methyl-2-thiophen-3-ylpyrimidin-4-yl)propylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-[1-(5-methyl-2-thiophen-3-ylpyrimidin-4-yl)propylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 67019039 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[(1S)-5-[3-[1-(5-methyl-2-thiophen-3-ylpyrimidin-4-yl)propylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | CCC(NCCCOc1ccc2c(c1)CC[C@H]2CC(=O)O)c1nc(-c2ccsc2)ncc1C |
| InChI | InChI=1S/C26H31N3O3S/c1-3-23(25-17(2)15-28-26(29-25)20-9-12-33-16-20)27-10-4-11-32-21-7-8-22-18(13-21)5-6-19(22)14-24(30)31/h7-9,12-13,15-16,19,23,27H,3-6,10-11,14H2,1-2H3,(H,30,31)/t19-,23?/m0/s1 |
| InChIKey | NWCGRPYOMNGZSU-HSTJUUNISA-N |
| XLogP | 5.53 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|