C27H30FN3O3 — CID 67019081
2-[(1S)-5-[3-[[2-(4-ethylphenyl)-5-fluoropyrimidin-4-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 67019081) has the molecular formula C27H30FN3O3 and a molecular weight of 463.55 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[[2-(4-ethylphenyl)-5-fluoropyrimidin-4-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-[[2-(4-ethylphenyl)-5-fluoropyrimidin-4-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 67019081 |
| Molecular Formula | C27H30FN3O3 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 2-[(1S)-5-[3-[[2-(4-ethylphenyl)-5-fluoropyrimidin-4-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | CCc1ccc(-c2ncc(F)c(CNCCCOc3ccc4c(c3)CC[C@H]4CC(=O)O)n2)cc1 |
| InChI | InChI=1S/C27H30FN3O3/c1-2-18-4-6-19(7-5-18)27-30-16-24(28)25(31-27)17-29-12-3-13-34-22-10-11-23-20(14-22)8-9-21(23)15-26(32)33/h4-7,10-11,14,16,21,29H,2-3,8-9,12-13,15,17H2,1H3,(H,32,33)/t21-/m0/s1 |
| InChIKey | NPJUSXOGHSDMGN-NRFANRHFSA-N |
| XLogP | 4.91 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|