C33H35N3O5 — CID 59300459
2-[(1S)-5-[3-[[2,5-bis(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 59300459) has the molecular formula C33H35N3O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[[2,5-bis(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-[[2,5-bis(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 59300459 |
| Molecular Formula | C33H35N3O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 2-[(1S)-5-[3-[[2,5-bis(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | COc1ccc(-c2ncc(-c3ccc(OC)cc3)c(N(C)CCCOc3ccc4c(c3)CC[C@H]4CC(=O)O)n2)cc1 |
| InChI | InChI=1S/C33H35N3O5/c1-36(17-4-18-41-28-15-16-29-24(19-28)5-6-25(29)20-31(37)38)33-30(22-7-11-26(39-2)12-8-22)21-34-32(35-33)23-9-13-27(40-3)14-10-23/h7-16,19,21,25H,4-6,17-18,20H2,1-3H3,(H,37,38)/t25-/m0/s1 |
| InChIKey | HUIHOWOLEOBHHZ-VWLOTQADSA-N |
| XLogP | 6.24 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|