C11H21NO — CID 105440804
(4-methyl-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-yl)methanol (PubChem CID 105440804) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (4-methyl-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-yl)methanol.
| Compound Name | (4-methyl-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-yl)methanol |
|---|---|
| PubChem CID | 105440804 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (4-methyl-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-yl)methanol |
| SMILES | CC1(CO)CCCC2CCCCN21 |
| InChI | InChI=1S/C11H21NO/c1-11(9-13)7-4-6-10-5-2-3-8-12(10)11/h10,13H,2-9H2,1H3 |
| InChIKey | OSPKSWYJBJSTQQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |