9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid

C9H15NO3 — CID 105441565

IUPAC9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid
SMILESO=C(O)C1CNC2(CCCC2)CO1
InChIInChI=1S/C9H15NO3/c11-8(12)7-5-10-9(6-13-7)3-1-2-4-9/h7,10H,1-6H2,(H,11,12)
InChIKeyPFQMGJDECMJARU-UHFFFAOYSA-N
MW185.22 g/mol
LogP0.37
Rot. Bonds1

About 9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid

9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid (PubChem CID 105441565) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid.

Molecular Properties

Compound Name9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid
PubChem CID105441565
Molecular FormulaC9H15NO3
Molecular Weight185.22 g/mol
Exact Mass185.11
IUPAC Name9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid
SMILESO=C(O)C1CNC2(CCCC2)CO1
InChIInChI=1S/C9H15NO3/c11-8(12)7-5-10-9(6-13-7)3-1-2-4-9/h7,10H,1-6H2,(H,11,12)
InChIKeyPFQMGJDECMJARU-UHFFFAOYSA-N
XLogP0.37
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.22
LogP ≤ 50.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-oxaspiro[4.5]decane-3-carboxylic acid
CID 154578314
1-azaspiro[5.5]undecan-3-yl hydrogen carbonate
CID 68900644
3-(methoxymethyl)-4-oxa-1-azaspiro[5.5]undecane
CID 63930005
3-thiophen-3-yl-4-oxa-1-azaspiro[5.5]undecane
CID 62522333
2,8-dioxaspiro[4.5]decane-3-carboxylic acid
CID 138990940
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane
CID 62521799
1-oxaspiro[4.4]nonane-2-carboxylic acid
CID 130585120
(2R)-spiro[2.5]octane-2-carboxylic acid
CID 10419388
ethane;morpholine-2-carboxylic acid
CID 170608685
4-azaspiro[2.6]nonane-5-carboxylic acid
CID 84653478
cyclohexane-1,1-dicarboxylic acid
CID 70539849
cyclotritriacontane-1,1,12,12,23,23-hexacarboxylic acid
CID 132573281

Frequently Asked Questions

What is the IUPAC name of 9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid?
The IUPAC name of 9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid (CID 105441565) is 9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid.
What is the SMILES notation for 9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid?
The canonical SMILES for 9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid is O=C(O)C1CNC2(CCCC2)CO1.
What is the InChIKey of 9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid?
The InChIKey is PFQMGJDECMJARU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c11-8(12)7-5-10-9(6-13-7)3-1-2-4-9/h7,10H,1-6H2,(H,11,12).
What are the key properties of 9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid?
9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid has a molecular weight of 185.22 g/mol, XLogP of 0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxa-6-azaspiro[4.5]decane-8-carboxylic acid is sourced from PubChem (CID 105441565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).