C10H14N4 — CID 105444445
(4-propyl-1H-imidazo[4,5-c]pyridin-6-yl)methanamine (PubChem CID 105444445) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is (4-propyl-1H-imidazo[4,5-c]pyridin-6-yl)methanamine.
| Compound Name | (4-propyl-1H-imidazo[4,5-c]pyridin-6-yl)methanamine |
|---|---|
| PubChem CID | 105444445 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (4-propyl-1H-imidazo[4,5-c]pyridin-6-yl)methanamine |
| SMILES | CCCc1nc(CN)cc2[nH]cnc12 |
| InChI | InChI=1S/C10H14N4/c1-2-3-8-10-9(12-6-13-10)4-7(5-11)14-8/h4,6H,2-3,5,11H2,1H3,(H,12,13) |
| InChIKey | QBSMDXOBLDDGNK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |