C7H13NO3S — CID 105445179
1,1-dioxo-5-propan-2-yl-1,4-thiazinan-3-one (PubChem CID 105445179) has the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. Its IUPAC name is 1,1-dioxo-5-propan-2-yl-1,4-thiazinan-3-one.
| Compound Name | 1,1-dioxo-5-propan-2-yl-1,4-thiazinan-3-one |
|---|---|
| PubChem CID | 105445179 |
| Molecular Formula | C7H13NO3S |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 1,1-dioxo-5-propan-2-yl-1,4-thiazinan-3-one |
| SMILES | CC(C)C1CS(=O)(=O)CC(=O)N1 |
| InChI | InChI=1S/C7H13NO3S/c1-5(2)6-3-12(10,11)4-7(9)8-6/h5-6H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | PDLCWBFIKODVBY-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |