C7H13NO3S — CID 20804951
2-tert-butyl-1,1-dioxo-1,3-thiazolidin-4-one (PubChem CID 20804951) has the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. Its IUPAC name is 2-tert-butyl-1,1-dioxo-1,3-thiazolidin-4-one.
| Compound Name | 2-tert-butyl-1,1-dioxo-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 20804951 |
| Molecular Formula | C7H13NO3S |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 2-tert-butyl-1,1-dioxo-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)C1NC(=O)CS1(=O)=O |
| InChI | InChI=1S/C7H13NO3S/c1-7(2,3)6-8-5(9)4-12(6,10)11/h6H,4H2,1-3H3,(H,8,9) |
| InChIKey | WDLJENNBLIFGQK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |