C11H18N2O5S — CID 97111452
tert-butyl (4aR,7aR)-1,1,3-trioxo-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]thiazine-6-carboxylate (PubChem CID 97111452) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is tert-butyl (4aR,7aR)-1,1,3-trioxo-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]thiazine-6-carboxylate.
| Compound Name | tert-butyl (4aR,7aR)-1,1,3-trioxo-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]thiazine-6-carboxylate |
|---|---|
| PubChem CID | 97111452 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | tert-butyl (4aR,7aR)-1,1,3-trioxo-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]thiazine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@@H](C1)NC(=O)CS2(=O)=O |
| InChI | InChI=1S/C11H18N2O5S/c1-11(2,3)18-10(15)13-4-7-8(5-13)19(16,17)6-9(14)12-7/h7-8H,4-6H2,1-3H3,(H,12,14)/t7-,8-/m1/s1 |
| InChIKey | TZTDDBQXUSNJML-HTQZYQBOSA-N |
| XLogP | -0.48 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |