C10H16N4 — CID 105446545
5-ethyl-3-(pyrrolidin-2-ylmethyl)-1,2,4-triazine (PubChem CID 105446545) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 5-ethyl-3-(pyrrolidin-2-ylmethyl)-1,2,4-triazine.
| Compound Name | 5-ethyl-3-(pyrrolidin-2-ylmethyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 105446545 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 5-ethyl-3-(pyrrolidin-2-ylmethyl)-1,2,4-triazine |
| SMILES | CCc1cnnc(CC2CCCN2)n1 |
| InChI | InChI=1S/C10H16N4/c1-2-8-7-12-14-10(13-8)6-9-4-3-5-11-9/h7,9,11H,2-6H2,1H3 |
| InChIKey | MBMLTSRHKIFYPI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |