C11H18N4 — CID 105459668
5-ethyl-3-(piperidin-4-ylmethyl)-1,2,4-triazine (PubChem CID 105459668) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 5-ethyl-3-(piperidin-4-ylmethyl)-1,2,4-triazine.
| Compound Name | 5-ethyl-3-(piperidin-4-ylmethyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 105459668 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 5-ethyl-3-(piperidin-4-ylmethyl)-1,2,4-triazine |
| SMILES | CCc1cnnc(CC2CCNCC2)n1 |
| InChI | InChI=1S/C11H18N4/c1-2-10-8-13-15-11(14-10)7-9-3-5-12-6-4-9/h8-9,12H,2-7H2,1H3 |
| InChIKey | RPGZKTIHORRWCF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |