C12H20N4 — CID 105476730
5-tert-butyl-3-(pyrrolidin-3-ylmethyl)-1,2,4-triazine (PubChem CID 105476730) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 5-tert-butyl-3-(pyrrolidin-3-ylmethyl)-1,2,4-triazine.
| Compound Name | 5-tert-butyl-3-(pyrrolidin-3-ylmethyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 105476730 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 5-tert-butyl-3-(pyrrolidin-3-ylmethyl)-1,2,4-triazine |
| SMILES | CC(C)(C)c1cnnc(CC2CCNC2)n1 |
| InChI | InChI=1S/C12H20N4/c1-12(2,3)10-8-14-16-11(15-10)6-9-4-5-13-7-9/h8-9,13H,4-7H2,1-3H3 |
| InChIKey | VOOMOQUTEIFWJR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |