C8H14ClF2N — CID 105451192
8,8-difluoro-2-azaspiro[4.4]nonane;hydrochloride (PubChem CID 105451192) has the molecular formula C8H14ClF2N and a molecular weight of 197.66 g/mol. Its IUPAC name is 8,8-difluoro-2-azaspiro[4.4]nonane;hydrochloride.
| Compound Name | 8,8-difluoro-2-azaspiro[4.4]nonane;hydrochloride |
|---|---|
| PubChem CID | 105451192 |
| Molecular Formula | C8H14ClF2N |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 8,8-difluoro-2-azaspiro[4.4]nonane;hydrochloride |
| SMILES | Cl.FC1(F)CCC2(CCNC2)C1 |
| InChI | InChI=1S/C8H13F2N.ClH/c9-8(10)2-1-7(5-8)3-4-11-6-7;/h11H,1-6H2;1H |
| InChIKey | YUOVRHOZEUMURF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |