C8H13ClF3N — CID 126836660
(3aR,6aR)-3a-(trifluoromethyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;hydrochloride (PubChem CID 126836660) has the molecular formula C8H13ClF3N and a molecular weight of 215.65 g/mol. Its IUPAC name is (3aR,6aR)-3a-(trifluoromethyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aR)-3a-(trifluoromethyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 126836660 |
| Molecular Formula | C8H13ClF3N |
| Molecular Weight | 215.65 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (3aR,6aR)-3a-(trifluoromethyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;hydrochloride |
| SMILES | Cl.FC(F)(F)[C@]12CCC[C@H]1CNC2 |
| InChI | InChI=1S/C8H12F3N.ClH/c9-8(10,11)7-3-1-2-6(7)4-12-5-7;/h6,12H,1-5H2;1H/t6-,7-;/m0./s1 |
| InChIKey | PASQNUWYVXKKRW-LEUCUCNGSA-N |
| XLogP | 2.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.65 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |