C10H18N2O2 — CID 105451701
methyl 1,5-diazabicyclo[4.3.1]decane-4-carboxylate (PubChem CID 105451701) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is methyl 1,5-diazabicyclo[4.3.1]decane-4-carboxylate.
| Compound Name | methyl 1,5-diazabicyclo[4.3.1]decane-4-carboxylate |
|---|---|
| PubChem CID | 105451701 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | methyl 1,5-diazabicyclo[4.3.1]decane-4-carboxylate |
| SMILES | COC(=O)C1CCN2CCCC(C2)N1 |
| InChI | InChI=1S/C10H18N2O2/c1-14-10(13)9-4-6-12-5-2-3-8(7-12)11-9/h8-9,11H,2-7H2,1H3 |
| InChIKey | HCGWBEAGKRPXDN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |