About 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride
1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride (PubChem CID 172821222) has the molecular formula C16H29ClN2O2
and a molecular weight of 316.87 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride |
| PubChem CID | 172821222 |
| Molecular Formula | C16H29ClN2O2 |
| Molecular Weight | 316.87 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride |
| SMILES | C1CN2CCC1CC2.COC(=O)C1CN2CCC1CC2.Cl |
| InChI | InChI=1S/C9H15NO2.C7H13N.ClH/c1-12-9(11)8-6-10-4-2-7(8)3-5-10;1-4-8-5-2-7(1)3-6-8;/h7-8H,2-6H2,1H3;7H,1-6H2;1H |
| InChIKey | UGFGOTWRVHBONT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.87 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride?
The IUPAC name of 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride (CID 172821222) is 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride.
What is the SMILES notation for 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride?
The canonical SMILES for 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride is C1CN2CCC1CC2.COC(=O)C1CN2CCC1CC2.Cl.
What is the InChIKey of 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride?
The InChIKey is UGFGOTWRVHBONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2.C7H13N.ClH/c1-12-9(11)8-6-10-4-2-7(8)3-5-10;1-4-8-5-2-7(1)3-6-8;/h7-8H,2-6H2,1H3;7H,1-6H2;1H.
What are the key properties of 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride?
1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride has a molecular weight of 316.87 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octane;methyl 1-azabicyclo[2.2.2]octane-3-carboxylate;hydrochloride is sourced from PubChem (CID 172821222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).