5-cyclopentylmorpholine-3-carboxylic acid

C10H17NO3 — CID 105452111

IUPAC5-cyclopentylmorpholine-3-carboxylic acid
SMILESO=C(O)C1COCC(C2CCCC2)N1
InChIInChI=1S/C10H17NO3/c12-10(13)9-6-14-5-8(11-9)7-3-1-2-4-7/h7-9,11H,1-6H2,(H,12,13)
InChIKeyJYRREWSKIDHPKQ-UHFFFAOYSA-N
MW199.25 g/mol
LogP0.62
Rot. Bonds2

About 5-cyclopentylmorpholine-3-carboxylic acid

5-cyclopentylmorpholine-3-carboxylic acid (PubChem CID 105452111) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 5-cyclopentylmorpholine-3-carboxylic acid.

Molecular Properties

Compound Name5-cyclopentylmorpholine-3-carboxylic acid
PubChem CID105452111
Molecular FormulaC10H17NO3
Molecular Weight199.25 g/mol
Exact Mass199.12
IUPAC Name5-cyclopentylmorpholine-3-carboxylic acid
SMILESO=C(O)C1COCC(C2CCCC2)N1
InChIInChI=1S/C10H17NO3/c12-10(13)9-6-14-5-8(11-9)7-3-1-2-4-7/h7-9,11H,1-6H2,(H,12,13)
InChIKeyJYRREWSKIDHPKQ-UHFFFAOYSA-N
XLogP0.62
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.25
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-cyclopentylmorpholine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

methyl 5-cyclopentylmorpholine-3-carboxylate
CID 105466772
5-cyclopentylpyrrolidine-2-carboxylic acid
CID 55295140
(2S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylic acid
CID 6543676
(6S)-piperidine-2,6-dicarboxylic acid
CID 126584428
(3aS,5S,7aS)-2,3,3a,4,5,6,7,7a-octahydrofuro[3,2-b]pyridine-5-carboxylic acid
CID 146155770
(1R,3S)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid
CID 134343960
(4S)-2-cycloheptyl-1,3-thiazolidine-4-carboxylic acid
CID 107774073
2-cyclohexyl-1,3-thiazolidine-4-carboxylic acid
CID 2732227
(2R,4S)-2-cyclohexyl-1,3-thiazolidine-4-carboxylic acid
CID 710168
(3S,4aS,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid
CID 23238234
(3S,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid
CID 23238236
(5R)-5-cyclopentylmorpholin-3-one
CID 97296648

Frequently Asked Questions

What is the IUPAC name of 5-cyclopentylmorpholine-3-carboxylic acid?
The IUPAC name of 5-cyclopentylmorpholine-3-carboxylic acid (CID 105452111) is 5-cyclopentylmorpholine-3-carboxylic acid.
What is the SMILES notation for 5-cyclopentylmorpholine-3-carboxylic acid?
The canonical SMILES for 5-cyclopentylmorpholine-3-carboxylic acid is O=C(O)C1COCC(C2CCCC2)N1.
What is the InChIKey of 5-cyclopentylmorpholine-3-carboxylic acid?
The InChIKey is JYRREWSKIDHPKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c12-10(13)9-6-14-5-8(11-9)7-3-1-2-4-7/h7-9,11H,1-6H2,(H,12,13).
What are the key properties of 5-cyclopentylmorpholine-3-carboxylic acid?
5-cyclopentylmorpholine-3-carboxylic acid has a molecular weight of 199.25 g/mol, XLogP of 0.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentylmorpholine-3-carboxylic acid is sourced from PubChem (CID 105452111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).